C28H39N2O11PS — CID 59132455
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenyl-3-phosphonooxybutan-2-yl]carbamate (PubChem CID 59132455) has the molecular formula C28H39N2O11PS and a molecular weight of 642.66 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenyl-3-phosphonooxybutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenyl-3-phosphonooxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59132455 |
| Molecular Formula | C28H39N2O11PS |
| Molecular Weight | 642.66 g/mol |
| Exact Mass | 642.20 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S)-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-phenyl-3-phosphonooxybutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)CC(OP(=O)(O)O)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)cc1 |
| InChI | InChI=1S/C28H39N2O11PS/c1-19(2)16-30(43(35,36)22-11-9-21(37-3)10-12-22)17-25(41-42(32,33)34)24(15-20-7-5-4-6-8-20)29-28(31)40-26-18-39-27-23(26)13-14-38-27/h4-12,19,23-27H,13-18H2,1-3H3,(H,29,31)(H2,32,33,34)/t23-,24-,25?,26-,27+/m0/s1 |
| InChIKey | HSPUSVUDVSRTGK-NWPIIZABSA-N |
| XLogP | 2.92 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|