C28H37N2O12PS — CID 89111544
3-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]prop-1-en-2-yloxymethylphosphonic acid (PubChem CID 89111544) has the molecular formula C28H37N2O12PS and a molecular weight of 656.65 g/mol. Its IUPAC name is 3-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]prop-1-en-2-yloxymethylphosphonic acid.
| Compound Name | 3-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]prop-1-en-2-yloxymethylphosphonic acid |
|---|---|
| PubChem CID | 89111544 |
| Molecular Formula | C28H37N2O12PS |
| Molecular Weight | 656.65 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | 3-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]prop-1-en-2-yloxymethylphosphonic acid |
| SMILES | C=C(CN(CC(O)C(Cc1ccccc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccc(OC)cc1)OCP(=O)(O)O |
| InChI | InChI=1S/C28H37N2O12PS/c1-19(41-18-43(33,34)35)15-30(44(36,37)22-10-8-21(38-2)9-11-22)16-25(31)24(14-20-6-4-3-5-7-20)29-28(32)42-26-17-40-27-23(26)12-13-39-27/h3-11,23-27,31H,1,12-18H2,2H3,(H,29,32)(H2,33,34,35) |
| InChIKey | FFEMMQXKWHCBMI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 190.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.65 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|