C34H43N2O11PS — CID 16729937
[4-[[(2R,3S)-3-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-(2-methylpropyl)sulfamoyl]phenoxy]methyl-phenoxyphosphinic acid (PubChem CID 16729937) has the molecular formula C34H43N2O11PS and a molecular weight of 718.76 g/mol. Its IUPAC name is [4-[[(2R,3S)-3-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-(2-methylpropyl)sulfamoyl]phenoxy]methyl-phenoxyphosphinic acid.
| Compound Name | [4-[[(2R,3S)-3-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-(2-methylpropyl)sulfamoyl]phenoxy]methyl-phenoxyphosphinic acid |
|---|---|
| PubChem CID | 16729937 |
| Molecular Formula | C34H43N2O11PS |
| Molecular Weight | 718.76 g/mol |
| Exact Mass | 718.23 |
| IUPAC Name | [4-[[(2R,3S)-3-[[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-2-hydroxy-4-phenylbutyl]-(2-methylpropyl)sulfamoyl]phenoxy]methyl-phenoxyphosphinic acid |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21)S(=O)(=O)c1ccc(OCP(=O)(O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C34H43N2O11PS/c1-24(2)20-36(49(41,42)28-15-13-26(14-16-28)45-23-48(39,40)47-27-11-7-4-8-12-27)21-31(37)30(19-25-9-5-3-6-10-25)35-34(38)46-32-22-44-33-29(32)17-18-43-33/h3-16,24,29-33,37H,17-23H2,1-2H3,(H,35,38)(H,39,40)/t29-,30-,31+,32-,33+/m0/s1 |
| InChIKey | NKDCVFOJAZXPRK-NKVOBILMSA-N |
| XLogP | 4.39 |
| TPSA | 170.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.76 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|