C28H38FN2O11PS — CID 71211772
[4-[(2S,3R)-2-[[(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-4-[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxybutyl]phenoxy]methylphosphonic acid (PubChem CID 71211772) has the molecular formula C28H38FN2O11PS and a molecular weight of 660.65 g/mol. Its IUPAC name is [4-[(2S,3R)-2-[[(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-4-[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxybutyl]phenoxy]methylphosphonic acid.
| Compound Name | [4-[(2S,3R)-2-[[(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-4-[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxybutyl]phenoxy]methylphosphonic acid |
|---|---|
| PubChem CID | 71211772 |
| Molecular Formula | C28H38FN2O11PS |
| Molecular Weight | 660.65 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | [4-[(2S,3R)-2-[[(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl]oxycarbonylamino]-4-[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxybutyl]phenoxy]methylphosphonic acid |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccc(OCP(=O)(O)O)cc1)NC(=O)OC1CO[C@H]2OCC[C@@H]12)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H38FN2O11PS/c1-18(2)14-31(44(37,38)22-9-5-20(29)6-10-22)15-25(32)24(13-19-3-7-21(8-4-19)41-17-43(34,35)36)30-28(33)42-26-16-40-27-23(26)11-12-39-27/h3-10,18,23-27,32H,11-17H2,1-2H3,(H,30,33)(H2,34,35,36)/t23-,24-,25+,26?,27+/m0/s1 |
| InChIKey | MJZMIPPKPZUTQI-VVLGCECJSA-N |
| XLogP | 2.45 |
| TPSA | 181.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|