C35H41FN2O10S — CID 20774269
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[(4-fluorophenyl)methoxy]phenyl]-3-hydroxybutan-2-yl]carbamate (PubChem CID 20774269) has the molecular formula C35H41FN2O10S and a molecular weight of 700.78 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[(4-fluorophenyl)methoxy]phenyl]-3-hydroxybutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[(4-fluorophenyl)methoxy]phenyl]-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 20774269 |
| Molecular Formula | C35H41FN2O10S |
| Molecular Weight | 700.78 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-1-[4-[(4-fluorophenyl)methoxy]phenyl]-3-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)CN(CC(O)C(Cc1ccc(OCc2ccc(F)cc2)cc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H41FN2O10S/c1-22(2)17-38(49(41,42)27-11-12-31-32(16-27)47-21-46-31)18-30(39)29(37-35(40)48-33-20-45-34-28(33)13-14-43-34)15-23-5-9-26(10-6-23)44-19-24-3-7-25(36)8-4-24/h3-12,16,22,28-30,33-34,39H,13-15,17-21H2,1-2H3,(H,37,40) |
| InChIKey | LYXXVTHYWPJDSW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |