C31H43N3O10S — CID 142654419
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-1-[4-(3-aminopropoxy)phenyl]-4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-3-hydroxybutan-2-yl]carbamate (PubChem CID 142654419) has the molecular formula C31H43N3O10S and a molecular weight of 649.76 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-1-[4-(3-aminopropoxy)phenyl]-4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-3-hydroxybutan-2-yl]carbamate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-1-[4-(3-aminopropoxy)phenyl]-4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-3-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142654419 |
| Molecular Formula | C31H43N3O10S |
| Molecular Weight | 649.76 g/mol |
| Exact Mass | 649.27 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl N-[(2S,3R)-1-[4-(3-aminopropoxy)phenyl]-4-[1,3-benzodioxol-5-ylsulfonyl(2-methylpropyl)amino]-3-hydroxybutan-2-yl]carbamate |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccc(OCCCN)cc1)NC(=O)OC1COC2OCCC12)S(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H43N3O10S/c1-20(2)16-34(45(37,38)23-8-9-27-28(15-23)43-19-42-27)17-26(35)25(14-21-4-6-22(7-5-21)39-12-3-11-32)33-31(36)44-29-18-41-30-24(29)10-13-40-30/h4-9,15,20,24-26,29-30,35H,3,10-14,16-19,32H2,1-2H3,(H,33,36)/t24?,25-,26+,29?,30?/m0/s1 |
| InChIKey | SKQAUBWFCCHFTD-KMMBHMKVSA-N |
| XLogP | 2.25 |
| TPSA | 168.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.76 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|