C31H43N2O11PS — CID 71174629
[(Z)-6-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]-5-methylhex-4-enyl]phosphonic acid (PubChem CID 71174629) has the molecular formula C31H43N2O11PS and a molecular weight of 682.73 g/mol. Its IUPAC name is [(Z)-6-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]-5-methylhex-4-enyl]phosphonic acid.
| Compound Name | [(Z)-6-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]-5-methylhex-4-enyl]phosphonic acid |
|---|---|
| PubChem CID | 71174629 |
| Molecular Formula | C31H43N2O11PS |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.23 |
| IUPAC Name | [(Z)-6-[[3-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yloxycarbonylamino)-2-hydroxy-4-phenylbutyl]-(4-methoxyphenyl)sulfonylamino]-5-methylhex-4-enyl]phosphonic acid |
| SMILES | COc1ccc(S(=O)(=O)N(C/C(C)=C\CCCP(=O)(O)O)CC(O)C(Cc2ccccc2)NC(=O)OC2COC3OCCC23)cc1 |
| InChI | InChI=1S/C31H43N2O11PS/c1-22(8-6-7-17-45(36,37)38)19-33(46(39,40)25-13-11-24(41-2)12-14-25)20-28(34)27(18-23-9-4-3-5-10-23)32-31(35)44-29-21-43-30-26(29)15-16-42-30/h3-5,8-14,26-30,34H,6-7,15-21H2,1-2H3,(H,32,35)(H2,36,37,38)/b22-8- |
| InChIKey | JWOSPWBBIBVFRX-UYOCIXKTSA-N |
| XLogP | 3.05 |
| TPSA | 181.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|