C29H40N4O7S — CID 24993210
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-acetamidophenyl)sulfonyl-(2-methylpropyl)amino]-3-amino-1-phenylbutan-2-yl]carbamate (PubChem CID 24993210) has the molecular formula C29H40N4O7S and a molecular weight of 588.73 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-acetamidophenyl)sulfonyl-(2-methylpropyl)amino]-3-amino-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-acetamidophenyl)sulfonyl-(2-methylpropyl)amino]-3-amino-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 24993210 |
| Molecular Formula | C29H40N4O7S |
| Molecular Weight | 588.73 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-4-[(4-acetamidophenyl)sulfonyl-(2-methylpropyl)amino]-3-amino-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](N)[C@H](Cc2ccccc2)NC(=O)O[C@H]2CO[C@H]3OCC[C@H]32)cc1 |
| InChI | InChI=1S/C29H40N4O7S/c1-19(2)16-33(41(36,37)23-11-9-22(10-12-23)31-20(3)34)17-25(30)26(15-21-7-5-4-6-8-21)32-29(35)40-27-18-39-28-24(27)13-14-38-28/h4-12,19,24-28H,13-18,30H2,1-3H3,(H,31,34)(H,32,35)/t24-,25+,26-,27-,28+/m0/s1 |
| InChIKey | IVXXUSCMIROCNF-IEAFHPEVSA-N |
| XLogP | 2.72 |
| TPSA | 149.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.73 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |