C30H39NO9S — CID 158384456
[(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4S)-3-[(4-formylphenyl)methyl]-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]pentanoate (PubChem CID 158384456) has the molecular formula C30H39NO9S and a molecular weight of 589.71 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4S)-3-[(4-formylphenyl)methyl]-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]pentanoate.
| Compound Name | [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4S)-3-[(4-formylphenyl)methyl]-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]pentanoate |
|---|---|
| PubChem CID | 158384456 |
| Molecular Formula | C30H39NO9S |
| Molecular Weight | 589.71 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4S)-3-[(4-formylphenyl)methyl]-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]pentanoate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)C(CC(=O)OC2CO[C@H]3OCC[C@@H]23)Cc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C30H39NO9S/c1-20(2)16-31(41(35,36)25-10-8-24(37-3)9-11-25)17-27(33)23(14-21-4-6-22(18-32)7-5-21)15-29(34)40-28-19-39-30-26(28)12-13-38-30/h4-11,18,20,23,26-28,30,33H,12-17,19H2,1-3H3/t23?,26-,27+,28?,30+/m0/s1 |
| InChIKey | CJLRJZQWBJEPON-QZXIWCKGSA-N |
| XLogP | 3.07 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|