C27H31F3N2O9S — CID 160652950
[(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4S)-3-benzyl-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-[(2,2,2-trifluoroacetyl)amino]amino]pentanoate (PubChem CID 160652950) has the molecular formula C27H31F3N2O9S and a molecular weight of 616.61 g/mol. Its IUPAC name is [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4S)-3-benzyl-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-[(2,2,2-trifluoroacetyl)amino]amino]pentanoate.
| Compound Name | [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4S)-3-benzyl-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-[(2,2,2-trifluoroacetyl)amino]amino]pentanoate |
|---|---|
| PubChem CID | 160652950 |
| Molecular Formula | C27H31F3N2O9S |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4S)-3-benzyl-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-[(2,2,2-trifluoroacetyl)amino]amino]pentanoate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)[C@@H](CC(=O)OC2CO[C@H]3OCCC23)Cc2ccccc2)NC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H31F3N2O9S/c1-38-19-7-9-20(10-8-19)42(36,37)32(31-26(35)27(28,29)30)15-22(33)18(13-17-5-3-2-4-6-17)14-24(34)41-23-16-40-25-21(23)11-12-39-25/h2-10,18,21-23,25,33H,11-16H2,1H3,(H,31,35)/t18-,21?,22-,23?,25-/m1/s1 |
| InChIKey | RKQVGVSFDLFYGR-DWKHHJKFSA-N |
| XLogP | 2.19 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|