C30H40N2O8S — CID 58271278
(2-oxo-3,3a,4,6,7,7a-hexahydro-1H-pyrano[4,3-b]pyrrol-7-yl) (3R,4S)-3-benzyl-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]pentanoate (PubChem CID 58271278) has the molecular formula C30H40N2O8S and a molecular weight of 588.72 g/mol. Its IUPAC name is (2-oxo-3,3a,4,6,7,7a-hexahydro-1H-pyrano[4,3-b]pyrrol-7-yl) (3R,4S)-3-benzyl-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]pentanoate.
| Compound Name | (2-oxo-3,3a,4,6,7,7a-hexahydro-1H-pyrano[4,3-b]pyrrol-7-yl) (3R,4S)-3-benzyl-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]pentanoate |
|---|---|
| PubChem CID | 58271278 |
| Molecular Formula | C30H40N2O8S |
| Molecular Weight | 588.72 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | (2-oxo-3,3a,4,6,7,7a-hexahydro-1H-pyrano[4,3-b]pyrrol-7-yl) (3R,4S)-3-benzyl-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]pentanoate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@@H](CC(=O)OC2COCC3CC(=O)NC32)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H40N2O8S/c1-20(2)16-32(41(36,37)25-11-9-24(38-3)10-12-25)17-26(33)22(13-21-7-5-4-6-8-21)15-29(35)40-27-19-39-18-23-14-28(34)31-30(23)27/h4-12,20,22-23,26-27,30,33H,13-19H2,1-3H3,(H,31,34)/t22-,23?,26-,27?,30?/m1/s1 |
| InChIKey | HTXJPIQKJZNUHT-QTJUAIBBSA-N |
| XLogP | 2.40 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.72 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |