C29H40N2O6S — CID 160933050
[(5R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-hydroxypentanoate (PubChem CID 160933050) has the molecular formula C29H40N2O6S and a molecular weight of 544.71 g/mol. Its IUPAC name is [(5R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-hydroxypentanoate.
| Compound Name | [(5R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-hydroxypentanoate |
|---|---|
| PubChem CID | 160933050 |
| Molecular Formula | C29H40N2O6S |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | [(5R,6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-hydroxypentanoate |
| SMILES | CC(C)CN(C[C@@H](O)[C@@H](CC(=O)O[C@@H]1CC2CCO[C@@H]2C1)Cc1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C29H40N2O6S/c1-20(2)18-31(38(34,35)26-10-8-24(30)9-11-26)19-27(32)23(14-21-6-4-3-5-7-21)16-29(33)37-25-15-22-12-13-36-28(22)17-25/h3-11,20,22-23,25,27-28,32H,12-19,30H2,1-2H3/t22?,23-,25-,27-,28-/m1/s1 |
| InChIKey | YDURAHQYXKIVQP-FSNVVORFSA-N |
| XLogP | 3.64 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|