C30H40FN3O8S — CID 158992424
[(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(3-amino-4-fluorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-benzyl-4-hydroxypentanoate (PubChem CID 158992424) has the molecular formula C30H40FN3O8S and a molecular weight of 621.73 g/mol. Its IUPAC name is [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(3-amino-4-fluorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-benzyl-4-hydroxypentanoate.
| Compound Name | [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(3-amino-4-fluorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-benzyl-4-hydroxypentanoate |
|---|---|
| PubChem CID | 158992424 |
| Molecular Formula | C30H40FN3O8S |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(3-amino-4-fluorophenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-benzyl-4-hydroxypentanoate |
| SMILES | CC(C)(C)OC(=O)NN(C[C@@H](O)[C@@H](CC(=O)OC1CC2CCO[C@@H]2C1)Cc1ccccc1)S(=O)(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C30H40FN3O8S/c1-30(2,3)42-29(37)33-34(43(38,39)23-9-10-24(31)25(32)17-23)18-26(35)21(13-19-7-5-4-6-8-19)15-28(36)41-22-14-20-11-12-40-27(20)16-22/h4-10,17,20-22,26-27,35H,11-16,18,32H2,1-3H3,(H,33,37)/t20?,21-,22?,26-,27-/m1/s1 |
| InChIKey | JQIDDSAWJSXPTL-OTOKDAMPSA-N |
| XLogP | 3.56 |
| TPSA | 157.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|