C29H39FN2O6S — CID 162105006
[(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-hydroxypentanoate (PubChem CID 162105006) has the molecular formula C29H39FN2O6S and a molecular weight of 562.70 g/mol. Its IUPAC name is [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-hydroxypentanoate.
| Compound Name | [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-hydroxypentanoate |
|---|---|
| PubChem CID | 162105006 |
| Molecular Formula | C29H39FN2O6S |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | [(6aR)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-yl] (3R,4S)-5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-hydroxypentanoate |
| SMILES | CC(C)CN(C[C@@H](O)[C@@H](CC(=O)OC1CC2CCO[C@@H]2C1)Cc1ccccc1)S(=O)(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C29H39FN2O6S/c1-19(2)17-32(39(35,36)24-8-9-25(30)26(31)16-24)18-27(33)22(12-20-6-4-3-5-7-20)14-29(34)38-23-13-21-10-11-37-28(21)15-23/h3-9,16,19,21-23,27-28,33H,10-15,17-18,31H2,1-2H3/t21?,22-,23?,27-,28-/m1/s1 |
| InChIKey | ZFJPTHGALSPACU-SMGNZUDISA-N |
| XLogP | 3.78 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|