C31H41NO8S — CID 160933510
[(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4S)-3-benzyl-4-hydroxy-5-[[4-[(E)-3-hydroxyprop-1-enyl]phenyl]sulfonyl-(2-methylpropyl)amino]pentanoate (PubChem CID 160933510) has the molecular formula C31H41NO8S and a molecular weight of 587.74 g/mol. Its IUPAC name is [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4S)-3-benzyl-4-hydroxy-5-[[4-[(E)-3-hydroxyprop-1-enyl]phenyl]sulfonyl-(2-methylpropyl)amino]pentanoate.
| Compound Name | [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4S)-3-benzyl-4-hydroxy-5-[[4-[(E)-3-hydroxyprop-1-enyl]phenyl]sulfonyl-(2-methylpropyl)amino]pentanoate |
|---|---|
| PubChem CID | 160933510 |
| Molecular Formula | C31H41NO8S |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4S)-3-benzyl-4-hydroxy-5-[[4-[(E)-3-hydroxyprop-1-enyl]phenyl]sulfonyl-(2-methylpropyl)amino]pentanoate |
| SMILES | CC(C)CN(C[C@@H](O)[C@@H](CC(=O)OC1CO[C@H]2OCCC12)Cc1ccccc1)S(=O)(=O)c1ccc(/C=C/CO)cc1 |
| InChI | InChI=1S/C31H41NO8S/c1-22(2)19-32(41(36,37)26-12-10-23(11-13-26)9-6-15-33)20-28(34)25(17-24-7-4-3-5-8-24)18-30(35)40-29-21-39-31-27(29)14-16-38-31/h3-13,22,25,27-29,31,33-34H,14-21H2,1-2H3/b9-6+/t25-,27?,28-,29?,31-/m1/s1 |
| InChIKey | STONZKGDNVLUPE-OKTNIRIASA-N |
| XLogP | 3.25 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |