C36H45NO9S — CID 159899038
[(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4R)-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-3-[(4-phenylmethoxyphenyl)methyl]pentanoate (PubChem CID 159899038) has the molecular formula C36H45NO9S and a molecular weight of 667.82 g/mol. Its IUPAC name is [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4R)-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-3-[(4-phenylmethoxyphenyl)methyl]pentanoate.
| Compound Name | [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4R)-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-3-[(4-phenylmethoxyphenyl)methyl]pentanoate |
|---|---|
| PubChem CID | 159899038 |
| Molecular Formula | C36H45NO9S |
| Molecular Weight | 667.82 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | [(6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (3R,4R)-4-hydroxy-5-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]-3-[(4-phenylmethoxyphenyl)methyl]pentanoate |
| SMILES | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@H](O)[C@@H](CC(=O)OC2CO[C@H]3OCCC23)Cc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H45NO9S/c1-25(2)21-37(47(40,41)31-15-13-29(42-3)14-16-31)22-33(38)28(20-35(39)46-34-24-45-36-32(34)17-18-43-36)19-26-9-11-30(12-10-26)44-23-27-7-5-4-6-8-27/h4-16,25,28,32-34,36,38H,17-24H2,1-3H3/t28-,32?,33+,34?,36-/m1/s1 |
| InChIKey | NVSGJTOLZNREOL-UPCMHDJVSA-N |
| XLogP | 4.84 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.82 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |