C23H35NO7S — CID 58259619
2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl (3R,4S)-3-benzyl-4-hydroxy-5-[2-methylpropyl(methylsulfonyl)amino]pentanoate (PubChem CID 58259619) has the molecular formula C23H35NO7S and a molecular weight of 469.60 g/mol. Its IUPAC name is 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl (3R,4S)-3-benzyl-4-hydroxy-5-[2-methylpropyl(methylsulfonyl)amino]pentanoate.
| Compound Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl (3R,4S)-3-benzyl-4-hydroxy-5-[2-methylpropyl(methylsulfonyl)amino]pentanoate |
|---|---|
| PubChem CID | 58259619 |
| Molecular Formula | C23H35NO7S |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl (3R,4S)-3-benzyl-4-hydroxy-5-[2-methylpropyl(methylsulfonyl)amino]pentanoate |
| SMILES | CC(C)CN(C[C@@H](O)[C@@H](CC(=O)OC1COC2OCCC12)Cc1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H35NO7S/c1-16(2)13-24(32(3,27)28)14-20(25)18(11-17-7-5-4-6-8-17)12-22(26)31-21-15-30-23-19(21)9-10-29-23/h4-8,16,18-21,23,25H,9-15H2,1-3H3/t18-,19?,20-,21?,23?/m1/s1 |
| InChIKey | XZZWTSRCNAZZNY-USHRCEHFSA-N |
| XLogP | 1.82 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |