C26H37N2O9PS — CID 58492175
oxolan-3-yl 5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-phosphonooxypentanoate (PubChem CID 58492175) has the molecular formula C26H37N2O9PS and a molecular weight of 584.63 g/mol. Its IUPAC name is oxolan-3-yl 5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-phosphonooxypentanoate.
| Compound Name | oxolan-3-yl 5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-phosphonooxypentanoate |
|---|---|
| PubChem CID | 58492175 |
| Molecular Formula | C26H37N2O9PS |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | oxolan-3-yl 5-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-benzyl-4-phosphonooxypentanoate |
| SMILES | CC(C)CN(CC(OP(=O)(O)O)C(CC(=O)OC1CCOC1)Cc1ccccc1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C26H37N2O9PS/c1-19(2)16-28(39(33,34)24-10-8-22(27)9-11-24)17-25(37-38(30,31)32)21(14-20-6-4-3-5-7-20)15-26(29)36-23-12-13-35-18-23/h3-11,19,21,23,25H,12-18,27H2,1-2H3,(H2,30,31,32) |
| InChIKey | JPMMVHRKDLOXFQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|