C25H36N3O9PS — CID 66693902
[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[hydroxy-[(3R)-oxolan-3-yl]oxyphosphoryl]oxy-1-phenylbutan-2-yl] carbamate (PubChem CID 66693902) has the molecular formula C25H36N3O9PS and a molecular weight of 585.62 g/mol. Its IUPAC name is [(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[hydroxy-[(3R)-oxolan-3-yl]oxyphosphoryl]oxy-1-phenylbutan-2-yl] carbamate.
| Compound Name | [(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[hydroxy-[(3R)-oxolan-3-yl]oxyphosphoryl]oxy-1-phenylbutan-2-yl] carbamate |
|---|---|
| PubChem CID | 66693902 |
| Molecular Formula | C25H36N3O9PS |
| Molecular Weight | 585.62 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | [(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[hydroxy-[(3R)-oxolan-3-yl]oxyphosphoryl]oxy-1-phenylbutan-2-yl] carbamate |
| SMILES | CC(C)CN(C[C@@H](OP(=O)(O)O[C@@H]1CCOC1)[C@H](Cc1ccccc1)OC(N)=O)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H36N3O9PS/c1-18(2)15-28(39(32,33)22-10-8-20(26)9-11-22)16-24(37-38(30,31)36-21-12-13-34-17-21)23(35-25(27)29)14-19-6-4-3-5-7-19/h3-11,18,21,23-24H,12-17,26H2,1-2H3,(H2,27,29)(H,30,31)/t21-,23+,24-/m1/s1 |
| InChIKey | GOFPWYJWDSVJMJ-YFNKSVMNSA-N |
| XLogP | 2.91 |
| TPSA | 180.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|