C25H34N3O11PS — CID 67065542
[(2S,3S)-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-4-[(3S)-oxolan-3-yl]-1-phenyl-3-phosphonooxybutan-2-yl] carbamate (PubChem CID 67065542) has the molecular formula C25H34N3O11PS and a molecular weight of 615.60 g/mol. Its IUPAC name is [(2S,3S)-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-4-[(3S)-oxolan-3-yl]-1-phenyl-3-phosphonooxybutan-2-yl] carbamate.
| Compound Name | [(2S,3S)-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-4-[(3S)-oxolan-3-yl]-1-phenyl-3-phosphonooxybutan-2-yl] carbamate |
|---|---|
| PubChem CID | 67065542 |
| Molecular Formula | C25H34N3O11PS |
| Molecular Weight | 615.60 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | [(2S,3S)-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-4-[(3S)-oxolan-3-yl]-1-phenyl-3-phosphonooxybutan-2-yl] carbamate |
| SMILES | CC(C)CN(C([C@@H]1CCOC1)[C@H](OP(=O)(O)O)[C@H](Cc1ccccc1)OC(N)=O)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H34N3O11PS/c1-17(2)15-27(41(35,36)21-10-8-20(9-11-21)28(30)31)23(19-12-13-37-16-19)24(39-40(32,33)34)22(38-25(26)29)14-18-6-4-3-5-7-18/h3-11,17,19,22-24H,12-16H2,1-2H3,(H2,26,29)(H2,32,33,34)/t19-,22+,23?,24-/m1/s1 |
| InChIKey | QPTBARPMLSTZME-BJHOICRXSA-N |
| XLogP | 2.83 |
| TPSA | 208.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.60 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|