C50H66N6O20P2S2+2 — CID 159802881
hydroxy-[(2R,3S)-1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl]oxy-oxophosphanium (PubChem CID 159802881) has the molecular formula C50H66N6O20P2S2+2 and a molecular weight of 1197.18 g/mol. Its IUPAC name is hydroxy-[(2R,3S)-1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl]oxy-oxophosphanium.
| Compound Name | hydroxy-[(2R,3S)-1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 159802881 |
| Molecular Formula | C50H66N6O20P2S2+2 |
| Molecular Weight | 1197.18 g/mol |
| Exact Mass | 1196.32 |
| IUPAC Name | hydroxy-[(2R,3S)-1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl]oxy-oxophosphanium |
| SMILES | CC(C)CN(C[C@@H](O[P+](=O)O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1.CC(C)CN(C[C@@H](O[P+](=O)O)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/2C25H32N3O10PS/c2*1-18(2)15-27(40(34,35)22-10-8-20(9-11-22)28(30)31)16-24(38-39(32)33)23(14-19-6-4-3-5-7-19)26-25(29)37-21-12-13-36-17-21/h2*3-11,18,21,23-24H,12-17H2,1-2H3,(H-,26,29,32,33)/p+2/t2*21-,23-,24+/m00/s1 |
| InChIKey | BWBMOCGMIWMJIS-YJJOYIBJSA-P |
| XLogP | 6.81 |
| TPSA | 349.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1197.18 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|