C30H41N3O10S — CID 20582852
[1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-(oxolan-3-yloxycarbonylamino)-4-phenylbutan-2-yl] 2-propoxyacetate (PubChem CID 20582852) has the molecular formula C30H41N3O10S and a molecular weight of 635.74 g/mol. Its IUPAC name is [1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-(oxolan-3-yloxycarbonylamino)-4-phenylbutan-2-yl] 2-propoxyacetate.
| Compound Name | [1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-(oxolan-3-yloxycarbonylamino)-4-phenylbutan-2-yl] 2-propoxyacetate |
|---|---|
| PubChem CID | 20582852 |
| Molecular Formula | C30H41N3O10S |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 635.25 |
| IUPAC Name | [1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-(oxolan-3-yloxycarbonylamino)-4-phenylbutan-2-yl] 2-propoxyacetate |
| SMILES | CCCOCC(=O)OC(CN(CC(C)C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(Cc1ccccc1)NC(=O)OC1CCOC1 |
| InChI | InChI=1S/C30H41N3O10S/c1-4-15-40-21-29(34)43-28(19-32(18-22(2)3)44(38,39)26-12-10-24(11-13-26)33(36)37)27(17-23-8-6-5-7-9-23)31-30(35)42-25-14-16-41-20-25/h5-13,22,25,27-28H,4,14-21H2,1-3H3,(H,31,35) |
| InChIKey | LNZCOEUDEZCQEC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 163.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|