C25H32IN3O8S — CID 56836975
[(3S)-oxolan-3-yl] N-[(2S,3R)-3-hydroxy-1-(4-iodophenyl)-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]butan-2-yl]carbamate (PubChem CID 56836975) has the molecular formula C25H32IN3O8S and a molecular weight of 661.52 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[(2S,3R)-3-hydroxy-1-(4-iodophenyl)-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]butan-2-yl]carbamate.
| Compound Name | [(3S)-oxolan-3-yl] N-[(2S,3R)-3-hydroxy-1-(4-iodophenyl)-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 56836975 |
| Molecular Formula | C25H32IN3O8S |
| Molecular Weight | 661.52 g/mol |
| Exact Mass | 661.10 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[(2S,3R)-3-hydroxy-1-(4-iodophenyl)-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]butan-2-yl]carbamate |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccc(I)cc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H32IN3O8S/c1-17(2)14-28(38(34,35)22-9-7-20(8-10-22)29(32)33)15-24(30)23(13-18-3-5-19(26)6-4-18)27-25(31)37-21-11-12-36-16-21/h3-10,17,21,23-24,30H,11-16H2,1-2H3,(H,27,31)/t21-,23-,24+/m0/s1 |
| InChIKey | XYQKTYUMZZDSOU-OEMFJLHTSA-N |
| XLogP | 3.33 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|