C27H35N3O10S — CID 59131481
[(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(4-hydroxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-(4-nitrophenyl)butan-2-yl]carbamate (PubChem CID 59131481) has the molecular formula C27H35N3O10S and a molecular weight of 593.66 g/mol. Its IUPAC name is [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(4-hydroxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-(4-nitrophenyl)butan-2-yl]carbamate.
| Compound Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(4-hydroxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-(4-nitrophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 59131481 |
| Molecular Formula | C27H35N3O10S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | [(3aS,4R,6aR)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-[(2S,3R)-3-hydroxy-4-[(4-hydroxyphenyl)sulfonyl-(2-methylpropyl)amino]-1-(4-nitrophenyl)butan-2-yl]carbamate |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)O[C@H]1CO[C@H]2OCC[C@H]21)S(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C27H35N3O10S/c1-17(2)14-29(41(36,37)21-9-7-20(31)8-10-21)15-24(32)23(13-18-3-5-19(6-4-18)30(34)35)28-27(33)40-25-16-39-26-22(25)11-12-38-26/h3-10,17,22-26,31-32H,11-16H2,1-2H3,(H,28,33)/t22-,23-,24+,25-,26+/m0/s1 |
| InChIKey | KPICJCGZJZCSJF-HEXNFIEUSA-N |
| XLogP | 2.41 |
| TPSA | 177.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|