C25H37N3O10S2 — CID 175469431
[(3S)-oxolan-3-yl] N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate;sulfuric acid (PubChem CID 175469431) has the molecular formula C25H37N3O10S2 and a molecular weight of 603.72 g/mol. Its IUPAC name is [(3S)-oxolan-3-yl] N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate;sulfuric acid.
| Compound Name | [(3S)-oxolan-3-yl] N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate;sulfuric acid |
|---|---|
| PubChem CID | 175469431 |
| Molecular Formula | C25H37N3O10S2 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | [(3S)-oxolan-3-yl] N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate;sulfuric acid |
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc(N)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C25H35N3O6S.H2O4S/c1-18(2)15-28(35(31,32)22-10-8-20(26)9-11-22)16-24(29)23(14-19-6-4-3-5-7-19)27-25(30)34-21-12-13-33-17-21;1-5(2,3)4/h3-11,18,21,23-24,29H,12-17,26H2,1-2H3,(H,27,30);(H2,1,2,3,4)/t21-,23?,24?;/m0./s1 |
| InChIKey | ZNJQZXJAYKDCBZ-MBPCXTFWSA-N |
| XLogP | 1.75 |
| TPSA | 205.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|