C25H34N3O7PS — CID 90908526
oxolan-3-yl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-1-phenyl-3-phosphorosooxybutan-2-yl]carbamate (PubChem CID 90908526) has the molecular formula C25H34N3O7PS and a molecular weight of 551.60 g/mol. Its IUPAC name is oxolan-3-yl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-1-phenyl-3-phosphorosooxybutan-2-yl]carbamate.
| Compound Name | oxolan-3-yl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-1-phenyl-3-phosphorosooxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 90908526 |
| Molecular Formula | C25H34N3O7PS |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | oxolan-3-yl N-[4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-1-phenyl-3-phosphorosooxybutan-2-yl]carbamate |
| SMILES | CC(C)CN(CC(OP=O)C(Cc1ccccc1)NC(=O)OC1CCOC1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H34N3O7PS/c1-18(2)15-28(37(31,32)22-10-8-20(26)9-11-22)16-24(35-36-30)23(14-19-6-4-3-5-7-19)27-25(29)34-21-12-13-33-17-21/h3-11,18,21,23-24H,12-17,26H2,1-2H3,(H,27,29) |
| InChIKey | LYSBXWPKDYNVHK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|