C30H47N4O9PS — CID 59326257
[(2R,3S)-1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 59326257) has the molecular formula C30H47N4O9PS and a molecular weight of 670.77 g/mol. Its IUPAC name is [(2R,3S)-1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R,3S)-1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 59326257 |
| Molecular Formula | C30H47N4O9PS |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.28 |
| IUPAC Name | [(2R,3S)-1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-[[(3S)-oxolan-3-yl]oxycarbonylamino]-4-phenylbutan-2-yl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC(C)CN(C[C@@H](OP(=O)([O-])OCC[N+](C)(C)C)[C@H](Cc1ccccc1)NC(=O)O[C@H]1CCOC1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C30H47N4O9PS/c1-23(2)20-33(45(38,39)27-13-11-25(31)12-14-27)21-29(43-44(36,37)41-18-16-34(3,4)5)28(19-24-9-7-6-8-10-24)32-30(35)42-26-15-17-40-22-26/h6-14,23,26,28-29H,15-22,31H2,1-5H3,(H-,32,35,36,37)/t26-,28-,29+/m0/s1 |
| InChIKey | OKIAJOVJDYXULO-PIZZNKLWSA-N |
| XLogP | 2.62 |
| TPSA | 169.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|