C24H32N3Na2O10PS — CID 59082694
disodium;[1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-(1,3-dioxolan-4-yloxycarbonylamino)-4-phenylbutan-2-yl] phosphate (PubChem CID 59082694) has the molecular formula C24H32N3Na2O10PS and a molecular weight of 631.55 g/mol. Its IUPAC name is disodium;[1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-(1,3-dioxolan-4-yloxycarbonylamino)-4-phenylbutan-2-yl] phosphate.
| Compound Name | disodium;[1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-(1,3-dioxolan-4-yloxycarbonylamino)-4-phenylbutan-2-yl] phosphate |
|---|---|
| PubChem CID | 59082694 |
| Molecular Formula | C24H32N3Na2O10PS |
| Molecular Weight | 631.55 g/mol |
| Exact Mass | 631.13 |
| IUPAC Name | disodium;[1-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-(1,3-dioxolan-4-yloxycarbonylamino)-4-phenylbutan-2-yl] phosphate |
| SMILES | CC(C)CN(CC(OP(=O)([O-])[O-])C(Cc1ccccc1)NC(=O)OC1COCO1)S(=O)(=O)c1ccc(N)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C24H34N3O10PS.2Na/c1-17(2)13-27(39(32,33)20-10-8-19(25)9-11-20)14-22(37-38(29,30)31)21(12-18-6-4-3-5-7-18)26-24(28)36-23-15-34-16-35-23;;/h3-11,17,21-23H,12-16,25H2,1-2H3,(H,26,28)(H2,29,30,31);;/q;2*+1/p-2 |
| InChIKey | SXHAQPFNXYEFIF-UHFFFAOYSA-L |
| XLogP | -5.19 |
| TPSA | 192.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.55 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|