C26H36N3O10PS — CID 20582850
methyl-[1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-(oxolan-2-yloxycarbonylamino)-4-phenylbutan-2-yl]oxyphosphinic acid (PubChem CID 20582850) has the molecular formula C26H36N3O10PS and a molecular weight of 613.63 g/mol. Its IUPAC name is methyl-[1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-(oxolan-2-yloxycarbonylamino)-4-phenylbutan-2-yl]oxyphosphinic acid.
| Compound Name | methyl-[1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-(oxolan-2-yloxycarbonylamino)-4-phenylbutan-2-yl]oxyphosphinic acid |
|---|---|
| PubChem CID | 20582850 |
| Molecular Formula | C26H36N3O10PS |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | methyl-[1-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-3-(oxolan-2-yloxycarbonylamino)-4-phenylbutan-2-yl]oxyphosphinic acid |
| SMILES | CC(C)CN(CC(OP(C)(=O)O)C(Cc1ccccc1)NC(=O)OC1CCCO1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H36N3O10PS/c1-19(2)17-28(41(35,36)22-13-11-21(12-14-22)29(31)32)18-24(39-40(3,33)34)23(16-20-8-5-4-6-9-20)27-26(30)38-25-10-7-15-37-25/h4-6,8-9,11-14,19,23-25H,7,10,15-18H2,1-3H3,(H,27,30)(H,33,34) |
| InChIKey | ZESVYLPKJXIDPG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 174.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|