C28H39N3O6S — CID 75985460
1-ethyl-N-[3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]cyclopentane-1-carboxamide (PubChem CID 75985460) has the molecular formula C28H39N3O6S and a molecular weight of 545.70 g/mol. Its IUPAC name is 1-ethyl-N-[3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]cyclopentane-1-carboxamide.
| Compound Name | 1-ethyl-N-[3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 75985460 |
| Molecular Formula | C28H39N3O6S |
| Molecular Weight | 545.70 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | 1-ethyl-N-[3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]cyclopentane-1-carboxamide |
| SMILES | CCC1(C(=O)NC(Cc2ccccc2)C(O)CN(CC(C)C)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CCCC1 |
| InChI | InChI=1S/C28H39N3O6S/c1-4-28(16-8-9-17-28)27(33)29-25(18-22-10-6-5-7-11-22)26(32)20-30(19-21(2)3)38(36,37)24-14-12-23(13-15-24)31(34)35/h5-7,10-15,21,25-26,32H,4,8-9,16-20H2,1-3H3,(H,29,33) |
| InChIKey | UDXWPSGEUOULAU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|