C27H31N7O6S — CID 146000884
N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-2-purin-9-ylacetamide (PubChem CID 146000884) has the molecular formula C27H31N7O6S and a molecular weight of 581.66 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-2-purin-9-ylacetamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-2-purin-9-ylacetamide |
|---|---|
| PubChem CID | 146000884 |
| Molecular Formula | C27H31N7O6S |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.21 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-2-purin-9-ylacetamide |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)Cn1cnc2cncnc21)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H31N7O6S/c1-19(2)14-33(41(39,40)22-10-8-21(9-11-22)34(37)38)15-25(35)23(12-20-6-4-3-5-7-20)31-26(36)16-32-18-30-24-13-28-17-29-27(24)32/h3-11,13,17-19,23,25,35H,12,14-16H2,1-2H3,(H,31,36)/t23-,25+/m0/s1 |
| InChIKey | BYDUBNSBVQUHPZ-UKILVPOCSA-N |
| XLogP | 2.17 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|