C27H30ClN7O6S — CID 146000181
2-(6-chloropurin-9-yl)-N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]acetamide (PubChem CID 146000181) has the molecular formula C27H30ClN7O6S and a molecular weight of 616.10 g/mol. Its IUPAC name is 2-(6-chloropurin-9-yl)-N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(6-chloropurin-9-yl)-N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 146000181 |
| Molecular Formula | C27H30ClN7O6S |
| Molecular Weight | 616.10 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | 2-(6-chloropurin-9-yl)-N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]acetamide |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)Cn1cnc2c(Cl)ncnc21)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H30ClN7O6S/c1-18(2)13-34(42(40,41)21-10-8-20(9-11-21)35(38)39)14-23(36)22(12-19-6-4-3-5-7-19)32-24(37)15-33-17-31-25-26(28)29-16-30-27(25)33/h3-11,16-18,22-23,36H,12-15H2,1-2H3,(H,32,37)/t22-,23+/m0/s1 |
| InChIKey | YQDWJKLCNQCHDP-XZOQPEGZSA-N |
| XLogP | 2.82 |
| TPSA | 173.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.10 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|