C35H46FN5O7S — CID 21337029
2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]-N-[3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-3,3-dimethylbutanamide (PubChem CID 21337029) has the molecular formula C35H46FN5O7S and a molecular weight of 699.85 g/mol. Its IUPAC name is 2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]-N-[3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-3,3-dimethylbutanamide.
| Compound Name | 2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]-N-[3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 21337029 |
| Molecular Formula | C35H46FN5O7S |
| Molecular Weight | 699.85 g/mol |
| Exact Mass | 699.31 |
| IUPAC Name | 2-[[2-[(3-fluorophenyl)methylamino]acetyl]amino]-N-[3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)NC(=O)C(NC(=O)CNCc1cccc(F)c1)C(C)(C)C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H46FN5O7S/c1-24(2)22-40(49(47,48)29-16-14-28(15-17-29)41(45)46)23-31(42)30(19-25-10-7-6-8-11-25)38-34(44)33(35(3,4)5)39-32(43)21-37-20-26-12-9-13-27(36)18-26/h6-18,24,30-31,33,37,42H,19-23H2,1-5H3,(H,38,44)(H,39,43) |
| InChIKey | RPTFULQVPLWRCL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 170.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.85 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|