C25H35N3O7S — CID 101151477
tert-butyl N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(3-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 101151477) has the molecular formula C25H35N3O7S and a molecular weight of 521.64 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(3-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(3-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 101151477 |
| Molecular Formula | C25H35N3O7S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(3-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H35N3O7S/c1-18(2)16-27(36(33,34)21-13-9-12-20(15-21)28(31)32)17-23(29)22(14-19-10-7-6-8-11-19)26-24(30)35-25(3,4)5/h6-13,15,18,22-23,29H,14,16-17H2,1-5H3,(H,26,30)/t22-,23+/m0/s1 |
| InChIKey | KIYYGGAIENMFBA-XZOQPEGZSA-N |
| XLogP | 3.74 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|