C24H33N3O8S — CID 58492224
tert-butyl N-[(2S)-3-hydroxy-4-[2-methoxyethyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 58492224) has the molecular formula C24H33N3O8S and a molecular weight of 523.61 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-hydroxy-4-[2-methoxyethyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-hydroxy-4-[2-methoxyethyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 58492224 |
| Molecular Formula | C24H33N3O8S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | tert-butyl N-[(2S)-3-hydroxy-4-[2-methoxyethyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COCCN(CC(O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H33N3O8S/c1-24(2,3)35-23(29)25-21(16-18-8-6-5-7-9-18)22(28)17-26(14-15-34-4)36(32,33)20-12-10-19(11-13-20)27(30)31/h5-13,21-22,28H,14-17H2,1-4H3,(H,25,29)/t21-,22?/m0/s1 |
| InChIKey | IXSSRAJHXFSXPY-HMTLIYDFSA-N |
| XLogP | 2.73 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|