C28H33N3O7S — CID 23385504
benzyl-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamic acid (PubChem CID 23385504) has the molecular formula C28H33N3O7S and a molecular weight of 555.65 g/mol. Its IUPAC name is benzyl-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamic acid.
| Compound Name | benzyl-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 23385504 |
| Molecular Formula | C28H33N3O7S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | benzyl-[(2S,3R)-3-hydroxy-4-[2-methylpropyl-(4-nitrophenyl)sulfonylamino]-1-phenylbutan-2-yl]carbamic acid |
| SMILES | CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)O)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H33N3O7S/c1-21(2)18-29(39(37,38)25-15-13-24(14-16-25)31(35)36)20-27(32)26(17-22-9-5-3-6-10-22)30(28(33)34)19-23-11-7-4-8-12-23/h3-16,21,26-27,32H,17-20H2,1-2H3,(H,33,34)/t26-,27+/m0/s1 |
| InChIKey | HVBPMHWBOBEIBE-RRPNLBNLSA-N |
| XLogP | 4.39 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|