C34H42N4O3S — CID 77171197
3,4-diamino-N-[3-(dibenzylamino)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 77171197) has the molecular formula C34H42N4O3S and a molecular weight of 586.80 g/mol. Its IUPAC name is 3,4-diamino-N-[3-(dibenzylamino)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 3,4-diamino-N-[3-(dibenzylamino)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 77171197 |
| Molecular Formula | C34H42N4O3S |
| Molecular Weight | 586.80 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | 3,4-diamino-N-[3-(dibenzylamino)-2-hydroxy-4-phenylbutyl]-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CC(O)C(Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)S(=O)(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C34H42N4O3S/c1-26(2)22-38(42(40,41)30-18-19-31(35)32(36)21-30)25-34(39)33(20-27-12-6-3-7-13-27)37(23-28-14-8-4-9-15-28)24-29-16-10-5-11-17-29/h3-19,21,26,33-34,39H,20,22-25,35-36H2,1-2H3 |
| InChIKey | WGXYXKUVOCLDBG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.80 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|