C20H28ClN3O3S — CID 66891192
3-amino-N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-4-chloro-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 66891192) has the molecular formula C20H28ClN3O3S and a molecular weight of 425.98 g/mol. Its IUPAC name is 3-amino-N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-4-chloro-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | 3-amino-N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-4-chloro-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 66891192 |
| Molecular Formula | C20H28ClN3O3S |
| Molecular Weight | 425.98 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-amino-N-[(2R,3S)-3-amino-2-hydroxy-4-phenylbutyl]-4-chloro-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(C[C@@H](O)[C@@H](N)Cc1ccccc1)S(=O)(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C20H28ClN3O3S/c1-14(2)12-24(28(26,27)16-8-9-17(21)18(22)11-16)13-20(25)19(23)10-15-6-4-3-5-7-15/h3-9,11,14,19-20,25H,10,12-13,22-23H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | FMDKQTFLUFKKHD-VQTJNVASSA-N |
| XLogP | 2.50 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.98 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|