C20H26Cl2N2O4S — CID 77164093
N-(3-amino-2-hydroxy-4-phenylbutyl)-3,5-dichloro-2-hydroxy-N-(2-methylpropyl)benzenesulfonamide (PubChem CID 77164093) has the molecular formula C20H26Cl2N2O4S and a molecular weight of 461.41 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-4-phenylbutyl)-3,5-dichloro-2-hydroxy-N-(2-methylpropyl)benzenesulfonamide.
| Compound Name | N-(3-amino-2-hydroxy-4-phenylbutyl)-3,5-dichloro-2-hydroxy-N-(2-methylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 77164093 |
| Molecular Formula | C20H26Cl2N2O4S |
| Molecular Weight | 461.41 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | N-(3-amino-2-hydroxy-4-phenylbutyl)-3,5-dichloro-2-hydroxy-N-(2-methylpropyl)benzenesulfonamide |
| SMILES | CC(C)CN(CC(O)C(N)Cc1ccccc1)S(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C20H26Cl2N2O4S/c1-13(2)11-24(12-18(25)17(23)8-14-6-4-3-5-7-14)29(27,28)19-10-15(21)9-16(22)20(19)26/h3-7,9-10,13,17-18,25-26H,8,11-12,23H2,1-2H3 |
| InChIKey | BPHUCVYEWSQXJK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|