C26H21Cl2NO3S — CID 146545797
N-benzyl-3,5-dichloro-2-hydroxy-N-[(3-phenylphenyl)methyl]benzenesulfonamide (PubChem CID 146545797) has the molecular formula C26H21Cl2NO3S and a molecular weight of 498.43 g/mol. Its IUPAC name is N-benzyl-3,5-dichloro-2-hydroxy-N-[(3-phenylphenyl)methyl]benzenesulfonamide.
| Compound Name | N-benzyl-3,5-dichloro-2-hydroxy-N-[(3-phenylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 146545797 |
| Molecular Formula | C26H21Cl2NO3S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | N-benzyl-3,5-dichloro-2-hydroxy-N-[(3-phenylphenyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1O)N(Cc1ccccc1)Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C26H21Cl2NO3S/c27-23-15-24(28)26(30)25(16-23)33(31,32)29(17-19-8-3-1-4-9-19)18-20-10-7-13-22(14-20)21-11-5-2-6-12-21/h1-16,30H,17-18H2 |
| InChIKey | GUHHZVSEHDZQLC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|