C29H25Cl2FN2O4S — CID 66616547
N-[[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl]methyl]-4-methylbenzamide (PubChem CID 66616547) has the molecular formula C29H25Cl2FN2O4S and a molecular weight of 587.50 g/mol. Its IUPAC name is N-[[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl]methyl]-4-methylbenzamide.
| Compound Name | N-[[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl]methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 66616547 |
| Molecular Formula | C29H25Cl2FN2O4S |
| Molecular Weight | 587.50 g/mol |
| Exact Mass | 586.09 |
| IUPAC Name | N-[[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl]methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2cccc(CN(Cc3ccc(F)cc3)S(=O)(=O)c3cc(Cl)cc(Cl)c3O)c2)cc1 |
| InChI | InChI=1S/C29H25Cl2FN2O4S/c1-19-5-9-23(10-6-19)29(36)33-16-21-3-2-4-22(13-21)18-34(17-20-7-11-25(32)12-8-20)39(37,38)27-15-24(30)14-26(31)28(27)35/h2-15,35H,16-18H2,1H3,(H,33,36) |
| InChIKey | PUZATALUKSEFIA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.50 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|