C30H28Cl2FN3O4S — CID 58531640
4-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[[4-(dimethylamino)phenyl]methyl]benzamide (PubChem CID 58531640) has the molecular formula C30H28Cl2FN3O4S and a molecular weight of 616.54 g/mol. Its IUPAC name is 4-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[[4-(dimethylamino)phenyl]methyl]benzamide.
| Compound Name | 4-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[[4-(dimethylamino)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 58531640 |
| Molecular Formula | C30H28Cl2FN3O4S |
| Molecular Weight | 616.54 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | 4-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-fluorophenyl)methyl]amino]methyl]-N-[[4-(dimethylamino)phenyl]methyl]benzamide |
| SMILES | CN(C)c1ccc(CNC(=O)c2ccc(CN(Cc3ccc(F)cc3)S(=O)(=O)c3cc(Cl)cc(Cl)c3O)cc2)cc1 |
| InChI | InChI=1S/C30H28Cl2FN3O4S/c1-35(2)26-13-7-20(8-14-26)17-34-30(38)23-9-3-21(4-10-23)18-36(19-22-5-11-25(33)12-6-22)41(39,40)28-16-24(31)15-27(32)29(28)37/h3-16,37H,17-19H2,1-2H3,(H,34,38) |
| InChIKey | LYPWDZVSBIMIRW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|