C21H19Cl2FN2O3S — CID 58531430
N-[[4-(aminomethyl)phenyl]methyl]-3,5-dichloro-N-[(4-fluorophenyl)methyl]-2-hydroxybenzenesulfonamide (PubChem CID 58531430) has the molecular formula C21H19Cl2FN2O3S and a molecular weight of 469.37 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-3,5-dichloro-N-[(4-fluorophenyl)methyl]-2-hydroxybenzenesulfonamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-3,5-dichloro-N-[(4-fluorophenyl)methyl]-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 58531430 |
| Molecular Formula | C21H19Cl2FN2O3S |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-3,5-dichloro-N-[(4-fluorophenyl)methyl]-2-hydroxybenzenesulfonamide |
| SMILES | NCc1ccc(CN(Cc2ccc(F)cc2)S(=O)(=O)c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C21H19Cl2FN2O3S/c22-17-9-19(23)21(27)20(10-17)30(28,29)26(13-16-5-7-18(24)8-6-16)12-15-3-1-14(11-25)2-4-15/h1-10,27H,11-13,25H2 |
| InChIKey | RVMPQQDKBHUMDF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|