C28H25Cl2NO4S — CID 143911703
3,5-dichloro-2-hydroxy-N-[[4-[hydroxy(phenyl)methyl]phenyl]methyl]-N-[(4-methylphenyl)methyl]benzenesulfonamide (PubChem CID 143911703) has the molecular formula C28H25Cl2NO4S and a molecular weight of 542.48 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-[[4-[hydroxy(phenyl)methyl]phenyl]methyl]-N-[(4-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-[[4-[hydroxy(phenyl)methyl]phenyl]methyl]-N-[(4-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 143911703 |
| Molecular Formula | C28H25Cl2NO4S |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-[[4-[hydroxy(phenyl)methyl]phenyl]methyl]-N-[(4-methylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(CN(Cc2ccc(C(O)c3ccccc3)cc2)S(=O)(=O)c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C28H25Cl2NO4S/c1-19-7-9-20(10-8-19)17-31(36(34,35)26-16-24(29)15-25(30)28(26)33)18-21-11-13-23(14-12-21)27(32)22-5-3-2-4-6-22/h2-16,27,32-33H,17-18H2,1H3 |
| InChIKey | OMRYGGKFXDKMRT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|