C34H27Cl3N2O7S2 — CID 66616696
4-chloro-3-[[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-phenylphenyl)methyl]amino]methyl]phenyl]methylsulfamoyl]benzoic acid (PubChem CID 66616696) has the molecular formula C34H27Cl3N2O7S2 and a molecular weight of 746.09 g/mol. Its IUPAC name is 4-chloro-3-[[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-phenylphenyl)methyl]amino]methyl]phenyl]methylsulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-phenylphenyl)methyl]amino]methyl]phenyl]methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 66616696 |
| Molecular Formula | C34H27Cl3N2O7S2 |
| Molecular Weight | 746.09 g/mol |
| Exact Mass | 744.03 |
| IUPAC Name | 4-chloro-3-[[3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonyl-[(4-phenylphenyl)methyl]amino]methyl]phenyl]methylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)NCc2cccc(CN(Cc3ccc(-c4ccccc4)cc3)S(=O)(=O)c3cc(Cl)cc(Cl)c3O)c2)c1 |
| InChI | InChI=1S/C34H27Cl3N2O7S2/c35-28-17-30(37)33(40)32(18-28)48(45,46)39(20-22-9-11-26(12-10-22)25-7-2-1-3-8-25)21-24-6-4-5-23(15-24)19-38-47(43,44)31-16-27(34(41)42)13-14-29(31)36/h1-18,38,40H,19-21H2,(H,41,42) |
| InChIKey | SOHQMIFKKORLCJ-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.09 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|