C16H16Cl2N2O4S — CID 166255880
3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]methyl]-N,N-dimethylbenzamide (PubChem CID 166255880) has the molecular formula C16H16Cl2N2O4S and a molecular weight of 403.29 g/mol. Its IUPAC name is 3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 166255880 |
| Molecular Formula | C16H16Cl2N2O4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 3-[[(3,5-dichloro-2-hydroxyphenyl)sulfonylamino]methyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(CNS(=O)(=O)c2cc(Cl)cc(Cl)c2O)c1 |
| InChI | InChI=1S/C16H16Cl2N2O4S/c1-20(2)16(22)11-5-3-4-10(6-11)9-19-25(23,24)14-8-12(17)7-13(18)15(14)21/h3-8,19,21H,9H2,1-2H3 |
| InChIKey | PXTHNNGFRSKXBP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|