C15H9Cl2F6NO3S — CID 3867018
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3,5-dichloro-2-hydroxybenzenesulfonamide (PubChem CID 3867018) has the molecular formula C15H9Cl2F6NO3S and a molecular weight of 468.20 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3,5-dichloro-2-hydroxybenzenesulfonamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3,5-dichloro-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 3867018 |
| Molecular Formula | C15H9Cl2F6NO3S |
| Molecular Weight | 468.20 g/mol |
| Exact Mass | 466.96 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3,5-dichloro-2-hydroxybenzenesulfonamide |
| SMILES | O=S(=O)(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H9Cl2F6NO3S/c16-10-4-11(17)13(25)12(5-10)28(26,27)24-6-7-1-8(14(18,19)20)3-9(2-7)15(21,22)23/h1-5,24-25H,6H2 |
| InChIKey | FSPANEPYERCZBI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.20 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|