C12H14Cl2N2O3S — CID 167781695
3,5-dichloro-N-(3-cyano-3-methylbutyl)-2-hydroxybenzenesulfonamide (PubChem CID 167781695) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is 3,5-dichloro-N-(3-cyano-3-methylbutyl)-2-hydroxybenzenesulfonamide.
| Compound Name | 3,5-dichloro-N-(3-cyano-3-methylbutyl)-2-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 167781695 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 3,5-dichloro-N-(3-cyano-3-methylbutyl)-2-hydroxybenzenesulfonamide |
| SMILES | CC(C)(C#N)CCNS(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H14Cl2N2O3S/c1-12(2,7-15)3-4-16-20(18,19)10-6-8(13)5-9(14)11(10)17/h5-6,16-17H,3-4H2,1-2H3 |
| InChIKey | BQVXCSIWSIWYDD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|