C14H17Cl3N2 — CID 106709051
2,2-dimethyl-6-(2,4,6-trichloroanilino)hexanenitrile (PubChem CID 106709051) has the molecular formula C14H17Cl3N2 and a molecular weight of 319.66 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2,4,6-trichloroanilino)hexanenitrile.
| Compound Name | 2,2-dimethyl-6-(2,4,6-trichloroanilino)hexanenitrile |
|---|---|
| PubChem CID | 106709051 |
| Molecular Formula | C14H17Cl3N2 |
| Molecular Weight | 319.66 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2,2-dimethyl-6-(2,4,6-trichloroanilino)hexanenitrile |
| SMILES | CC(C)(C#N)CCCCNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl3N2/c1-14(2,9-18)5-3-4-6-19-13-11(16)7-10(15)8-12(13)17/h7-8,19H,3-6H2,1-2H3 |
| InChIKey | OFGMXFZLONUOPC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|