C13H14Cl2N4S — CID 65473689
5-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]-2,2-dimethylpentanenitrile (PubChem CID 65473689) has the molecular formula C13H14Cl2N4S and a molecular weight of 329.26 g/mol. Its IUPAC name is 5-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65473689 |
| Molecular Formula | C13H14Cl2N4S |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 5-[(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)amino]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCNc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C13H14Cl2N4S/c1-13(2,7-16)4-3-5-17-10-8(14)6-9(15)11-12(10)19-20-18-11/h6,17H,3-5H2,1-2H3 |
| InChIKey | FIDOUJIAKJWSQD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|